C15H14FNO3 — CID 102125711
15-fluoro-11,13-dioxo-12-oxapentacyclo[4.4.3.12,5.17,10.01,6]pentadecane-14-carbonitrile (PubChem CID 102125711) has the molecular formula C15H14FNO3 and a molecular weight of 275.28 g/mol. Its IUPAC name is 15-fluoro-11,13-dioxo-12-oxapentacyclo[4.4.3.12,5.17,10.01,6]pentadecane-14-carbonitrile.
| Compound Name | 15-fluoro-11,13-dioxo-12-oxapentacyclo[4.4.3.12,5.17,10.01,6]pentadecane-14-carbonitrile |
|---|---|
| PubChem CID | 102125711 |
| Molecular Formula | C15H14FNO3 |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 15-fluoro-11,13-dioxo-12-oxapentacyclo[4.4.3.12,5.17,10.01,6]pentadecane-14-carbonitrile |
| SMILES | N#CC1C2CCC1C13C(=O)OC(=O)C21C1CCC3C1F |
| InChI | InChI=1S/C15H14FNO3/c16-11-9-3-4-10(11)15-8-2-1-7(6(8)5-17)14(9,15)12(18)20-13(15)19/h6-11H,1-4H2 |
| InChIKey | HDPQQYKDFZYUFA-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|