C14H14FIO3 — CID 102125712
14-fluoro-15-iodo-12-oxapentacyclo[4.4.3.12,5.17,10.01,6]pentadecane-11,13-dione (PubChem CID 102125712) has the molecular formula C14H14FIO3 and a molecular weight of 376.17 g/mol. Its IUPAC name is 14-fluoro-15-iodo-12-oxapentacyclo[4.4.3.12,5.17,10.01,6]pentadecane-11,13-dione.
| Compound Name | 14-fluoro-15-iodo-12-oxapentacyclo[4.4.3.12,5.17,10.01,6]pentadecane-11,13-dione |
|---|---|
| PubChem CID | 102125712 |
| Molecular Formula | C14H14FIO3 |
| Molecular Weight | 376.17 g/mol |
| Exact Mass | 376.00 |
| IUPAC Name | 14-fluoro-15-iodo-12-oxapentacyclo[4.4.3.12,5.17,10.01,6]pentadecane-11,13-dione |
| SMILES | O=C1OC(=O)C23C4CCC(C4F)C12C1CCC3C1I |
| InChI | InChI=1S/C14H14FIO3/c15-9-5-1-2-6(9)14-8-4-3-7(10(8)16)13(5,14)11(17)19-12(14)18/h5-10H,1-4H2 |
| InChIKey | MUCAMJQVMUVDAI-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.17 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|