About triethyl-[2-[(2R,4S)-2-(4-fluorophenyl)oxan-4-yl]ethynyl]silane
triethyl-[2-[(2R,4S)-2-(4-fluorophenyl)oxan-4-yl]ethynyl]silane (PubChem CID 102126070) has the molecular formula C19H27FOSi
and a molecular weight of 318.51 g/mol. Its IUPAC name is triethyl-[2-[(2R,4S)-2-(4-fluorophenyl)oxan-4-yl]ethynyl]silane.
Molecular Properties
| Compound Name | triethyl-[2-[(2R,4S)-2-(4-fluorophenyl)oxan-4-yl]ethynyl]silane |
| PubChem CID | 102126070 |
| Molecular Formula | C19H27FOSi |
| Molecular Weight | 318.51 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | triethyl-[2-[(2R,4S)-2-(4-fluorophenyl)oxan-4-yl]ethynyl]silane |
| SMILES | CC[Si](C#C[C@H]1CCO[C@@H](c2ccc(F)cc2)C1)(CC)CC |
| InChI | InChI=1S/C19H27FOSi/c1-4-22(5-2,6-3)14-12-16-11-13-21-19(15-16)17-7-9-18(20)10-8-17/h7-10,16,19H,4-6,11,13,15H2,1-3H3/t16-,19-/m1/s1 |
| InChIKey | XEHGUTIFJXVPFK-VQIMIIECSA-N |
| XLogP | 5.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.51 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze triethyl-[2-[(2R,4S)-2-(4-fluorophenyl)oxan-4-yl]ethynyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl-[2-[(2R,4S)-2-(4-fluorophenyl)oxan-4-yl]ethynyl]silane?
The IUPAC name of triethyl-[2-[(2R,4S)-2-(4-fluorophenyl)oxan-4-yl]ethynyl]silane (CID 102126070) is triethyl-[2-[(2R,4S)-2-(4-fluorophenyl)oxan-4-yl]ethynyl]silane.
What is the SMILES notation for triethyl-[2-[(2R,4S)-2-(4-fluorophenyl)oxan-4-yl]ethynyl]silane?
The canonical SMILES for triethyl-[2-[(2R,4S)-2-(4-fluorophenyl)oxan-4-yl]ethynyl]silane is CC[Si](C#C[C@H]1CCO[C@@H](c2ccc(F)cc2)C1)(CC)CC.
What is the InChIKey of triethyl-[2-[(2R,4S)-2-(4-fluorophenyl)oxan-4-yl]ethynyl]silane?
The InChIKey is XEHGUTIFJXVPFK-VQIMIIECSA-N. The full InChI is InChI=1S/C19H27FOSi/c1-4-22(5-2,6-3)14-12-16-11-13-21-19(15-16)17-7-9-18(20)10-8-17/h7-10,16,19H,4-6,11,13,15H2,1-3H3/t16-,19-/m1/s1.
What are the key properties of triethyl-[2-[(2R,4S)-2-(4-fluorophenyl)oxan-4-yl]ethynyl]silane?
triethyl-[2-[(2R,4S)-2-(4-fluorophenyl)oxan-4-yl]ethynyl]silane has a molecular weight of 318.51 g/mol, XLogP of 5.34, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl-[2-[(2R,4S)-2-(4-fluorophenyl)oxan-4-yl]ethynyl]silane is sourced from PubChem (CID 102126070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).