C29H23ClN2O2S — CID 102126195
2-(4-chlorophenyl)-3-(4-methylphenyl)sulfonyl-4,6-diphenyl-4H-pyrimidine (PubChem CID 102126195) has the molecular formula C29H23ClN2O2S and a molecular weight of 499.04 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3-(4-methylphenyl)sulfonyl-4,6-diphenyl-4H-pyrimidine.
| Compound Name | 2-(4-chlorophenyl)-3-(4-methylphenyl)sulfonyl-4,6-diphenyl-4H-pyrimidine |
|---|---|
| PubChem CID | 102126195 |
| Molecular Formula | C29H23ClN2O2S |
| Molecular Weight | 499.04 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | 2-(4-chlorophenyl)-3-(4-methylphenyl)sulfonyl-4,6-diphenyl-4H-pyrimidine |
| SMILES | Cc1ccc(S(=O)(=O)N2C(c3ccc(Cl)cc3)=NC(c3ccccc3)=CC2c2ccccc2)cc1 |
| InChI | InChI=1S/C29H23ClN2O2S/c1-21-12-18-26(19-13-21)35(33,34)32-28(23-10-6-3-7-11-23)20-27(22-8-4-2-5-9-22)31-29(32)24-14-16-25(30)17-15-24/h2-20,28H,1H3 |
| InChIKey | ZXXYXWWDNYYIEU-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.04 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |