C19H30O7 — CID 102126257
2,4,4-trimethyl-3-[3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]cyclohexa-2,5-dien-1-one (PubChem CID 102126257) has the molecular formula C19H30O7 and a molecular weight of 370.44 g/mol. Its IUPAC name is 2,4,4-trimethyl-3-[3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]cyclohexa-2,5-dien-1-one.
| Compound Name | 2,4,4-trimethyl-3-[3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]cyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 102126257 |
| Molecular Formula | C19H30O7 |
| Molecular Weight | 370.44 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 2,4,4-trimethyl-3-[3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]cyclohexa-2,5-dien-1-one |
| SMILES | CC1=C(CCC(C)O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)C(C)(C)C=CC1=O |
| InChI | InChI=1S/C19H30O7/c1-10(5-6-12-11(2)13(21)7-8-19(12,3)4)25-18-17(24)16(23)15(22)14(9-20)26-18/h7-8,10,14-18,20,22-24H,5-6,9H2,1-4H3/t10?,14-,15-,16+,17-,18-/m1/s1 |
| InChIKey | ZYAQCHNNKHSVAY-CAOIYLRSSA-N |
| XLogP | 0.45 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.44 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |