C26H20N2O — CID 102126374
(11R,14S)-14,16-diphenyl-12-oxa-2,15-diazatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3,5,7,9,16-hexaene (PubChem CID 102126374) has the molecular formula C26H20N2O and a molecular weight of 376.46 g/mol. Its IUPAC name is (11R,14S)-14,16-diphenyl-12-oxa-2,15-diazatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3,5,7,9,16-hexaene.
| Compound Name | (11R,14S)-14,16-diphenyl-12-oxa-2,15-diazatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3,5,7,9,16-hexaene |
|---|---|
| PubChem CID | 102126374 |
| Molecular Formula | C26H20N2O |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | (11R,14S)-14,16-diphenyl-12-oxa-2,15-diazatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3,5,7,9,16-hexaene |
| SMILES | C1=C(c2ccccc2)N2[C@@H](c3ccccc3)CO[C@@H]2c2cc3ccccc3nc21 |
| InChI | InChI=1S/C26H20N2O/c1-3-9-18(10-4-1)24-16-23-21(15-20-13-7-8-14-22(20)27-23)26-28(24)25(17-29-26)19-11-5-2-6-12-19/h1-16,25-26H,17H2/t25-,26-/m1/s1 |
| InChIKey | NPDKUVNXCNWSHU-CLJLJLNGSA-N |
| XLogP | 5.82 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |