C31H32N2O9 — CID 102126575
7,9,11-tris(4-methoxyphenyl)-3,3-dimethyl-10-nitro-2,4-dioxa-8-azaspiro[5.5]undecane-1,5-dione (PubChem CID 102126575) has the molecular formula C31H32N2O9 and a molecular weight of 576.60 g/mol. Its IUPAC name is 7,9,11-tris(4-methoxyphenyl)-3,3-dimethyl-10-nitro-2,4-dioxa-8-azaspiro[5.5]undecane-1,5-dione.
| Compound Name | 7,9,11-tris(4-methoxyphenyl)-3,3-dimethyl-10-nitro-2,4-dioxa-8-azaspiro[5.5]undecane-1,5-dione |
|---|---|
| PubChem CID | 102126575 |
| Molecular Formula | C31H32N2O9 |
| Molecular Weight | 576.60 g/mol |
| Exact Mass | 576.21 |
| IUPAC Name | 7,9,11-tris(4-methoxyphenyl)-3,3-dimethyl-10-nitro-2,4-dioxa-8-azaspiro[5.5]undecane-1,5-dione |
| SMILES | COc1ccc(C2NC(c3ccc(OC)cc3)C3(C(=O)OC(C)(C)OC3=O)C(c3ccc(OC)cc3)C2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C31H32N2O9/c1-30(2)41-28(34)31(29(35)42-30)24(18-6-12-21(38-3)13-7-18)26(33(36)37)25(19-8-14-22(39-4)15-9-19)32-27(31)20-10-16-23(40-5)17-11-20/h6-17,24-27,32H,1-5H3 |
| InChIKey | QPNCISROQSJVBE-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 135.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.60 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|