C41H34Cl2N2O9 — CID 102126576
7,9-bis[3-(4-chlorophenoxy)phenyl]-11-(4-methoxyphenyl)-3,3-dimethyl-10-nitro-2,4-dioxa-8-azaspiro[5.5]undecane-1,5-dione (PubChem CID 102126576) has the molecular formula C41H34Cl2N2O9 and a molecular weight of 769.63 g/mol. Its IUPAC name is 7,9-bis[3-(4-chlorophenoxy)phenyl]-11-(4-methoxyphenyl)-3,3-dimethyl-10-nitro-2,4-dioxa-8-azaspiro[5.5]undecane-1,5-dione.
| Compound Name | 7,9-bis[3-(4-chlorophenoxy)phenyl]-11-(4-methoxyphenyl)-3,3-dimethyl-10-nitro-2,4-dioxa-8-azaspiro[5.5]undecane-1,5-dione |
|---|---|
| PubChem CID | 102126576 |
| Molecular Formula | C41H34Cl2N2O9 |
| Molecular Weight | 769.63 g/mol |
| Exact Mass | 768.16 |
| IUPAC Name | 7,9-bis[3-(4-chlorophenoxy)phenyl]-11-(4-methoxyphenyl)-3,3-dimethyl-10-nitro-2,4-dioxa-8-azaspiro[5.5]undecane-1,5-dione |
| SMILES | COc1ccc(C2C([N+](=O)[O-])C(c3cccc(Oc4ccc(Cl)cc4)c3)NC(c3cccc(Oc4ccc(Cl)cc4)c3)C23C(=O)OC(C)(C)OC3=O)cc1 |
| InChI | InChI=1S/C41H34Cl2N2O9/c1-40(2)53-38(46)41(39(47)54-40)34(24-10-16-29(50-3)17-11-24)36(45(48)49)35(25-6-4-8-32(22-25)51-30-18-12-27(42)13-19-30)44-37(41)26-7-5-9-33(23-26)52-31-20-14-28(43)15-21-31/h4-23,34-37,44H,1-3H3 |
| InChIKey | XMYMAKVSNAESPR-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 135.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.63 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|