C25H18F6S2 — CID 102126594
1,2-diethyl-12,12,13,13,14,14-hexafluoro-3,23-dithiahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-4,6,8,10,15,17,19,21-octaene (PubChem CID 102126594) has the molecular formula C25H18F6S2 and a molecular weight of 496.54 g/mol. Its IUPAC name is 1,2-diethyl-12,12,13,13,14,14-hexafluoro-3,23-dithiahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-4,6,8,10,15,17,19,21-octaene.
| Compound Name | 1,2-diethyl-12,12,13,13,14,14-hexafluoro-3,23-dithiahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-4,6,8,10,15,17,19,21-octaene |
|---|---|
| PubChem CID | 102126594 |
| Molecular Formula | C25H18F6S2 |
| Molecular Weight | 496.54 g/mol |
| Exact Mass | 496.08 |
| IUPAC Name | 1,2-diethyl-12,12,13,13,14,14-hexafluoro-3,23-dithiahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-4,6,8,10,15,17,19,21-octaene |
| SMILES | CCC12Sc3ccccc3C1=C1C(=C3c4ccccc4SC32CC)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C25H18F6S2/c1-3-21-17(13-9-5-7-11-15(13)32-21)19-20(24(28,29)25(30,31)23(19,26)27)18-14-10-6-8-12-16(14)33-22(18,21)4-2/h5-12H,3-4H2,1-2H3 |
| InChIKey | FUMGSIVKRXTFJU-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.54 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|