C15H18BrNO3 — CID 102126953
tert-butyl (3aS,8bR)-8b-bromo-2,3a-dihydro-1H-furo[2,3-b]indole-4-carboxylate (PubChem CID 102126953) has the molecular formula C15H18BrNO3 and a molecular weight of 340.22 g/mol. Its IUPAC name is tert-butyl (3aS,8bR)-8b-bromo-2,3a-dihydro-1H-furo[2,3-b]indole-4-carboxylate.
| Compound Name | tert-butyl (3aS,8bR)-8b-bromo-2,3a-dihydro-1H-furo[2,3-b]indole-4-carboxylate |
|---|---|
| PubChem CID | 102126953 |
| Molecular Formula | C15H18BrNO3 |
| Molecular Weight | 340.22 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | tert-butyl (3aS,8bR)-8b-bromo-2,3a-dihydro-1H-furo[2,3-b]indole-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1c2ccccc2[C@]2(Br)CCO[C@H]12 |
| InChI | InChI=1S/C15H18BrNO3/c1-14(2,3)20-13(18)17-11-7-5-4-6-10(11)15(16)8-9-19-12(15)17/h4-7,12H,8-9H2,1-3H3/t12-,15+/m0/s1 |
| InChIKey | CURBRVNDUORNMM-SWLSCSKDSA-N |
| XLogP | 3.78 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.22 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|