About S-piperidin-1-yl 5-oxobenzo[b][1,7]naphthyridine-10-carbothioate
S-piperidin-1-yl 5-oxobenzo[b][1,7]naphthyridine-10-carbothioate (PubChem CID 102126970) has the molecular formula C18H17N3O2S
and a molecular weight of 339.42 g/mol. Its IUPAC name is S-piperidin-1-yl 5-oxobenzo[b][1,7]naphthyridine-10-carbothioate.
Molecular Properties
| Compound Name | S-piperidin-1-yl 5-oxobenzo[b][1,7]naphthyridine-10-carbothioate |
| PubChem CID | 102126970 |
| Molecular Formula | C18H17N3O2S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | S-piperidin-1-yl 5-oxobenzo[b][1,7]naphthyridine-10-carbothioate |
| SMILES | O=C(SN1CCCCC1)n1c2ccccc2c(=O)c2ccncc21 |
| InChI | InChI=1S/C18H17N3O2S/c22-17-13-6-2-3-7-15(13)21(16-12-19-9-8-14(16)17)18(23)24-20-10-4-1-5-11-20/h2-3,6-9,12H,1,4-5,10-11H2 |
| InChIKey | XFRHNCNKDFAEGJ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-piperidin-1-yl 5-oxobenzo[b][1,7]naphthyridine-10-carbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-piperidin-1-yl 5-oxobenzo[b][1,7]naphthyridine-10-carbothioate?
The IUPAC name of S-piperidin-1-yl 5-oxobenzo[b][1,7]naphthyridine-10-carbothioate (CID 102126970) is S-piperidin-1-yl 5-oxobenzo[b][1,7]naphthyridine-10-carbothioate.
What is the SMILES notation for S-piperidin-1-yl 5-oxobenzo[b][1,7]naphthyridine-10-carbothioate?
The canonical SMILES for S-piperidin-1-yl 5-oxobenzo[b][1,7]naphthyridine-10-carbothioate is O=C(SN1CCCCC1)n1c2ccccc2c(=O)c2ccncc21.
What is the InChIKey of S-piperidin-1-yl 5-oxobenzo[b][1,7]naphthyridine-10-carbothioate?
The InChIKey is XFRHNCNKDFAEGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N3O2S/c22-17-13-6-2-3-7-15(13)21(16-12-19-9-8-14(16)17)18(23)24-20-10-4-1-5-11-20/h2-3,6-9,12H,1,4-5,10-11H2.
What are the key properties of S-piperidin-1-yl 5-oxobenzo[b][1,7]naphthyridine-10-carbothioate?
S-piperidin-1-yl 5-oxobenzo[b][1,7]naphthyridine-10-carbothioate has a molecular weight of 339.42 g/mol, XLogP of 3.65, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for S-piperidin-1-yl 5-oxobenzo[b][1,7]naphthyridine-10-carbothioate is sourced from PubChem (CID 102126970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).