C21H22Cl2N6O2 — CID 102127232
N-(4-chlorophenyl)-5-[(6-chloro-3-pyridinyl)methyl]-7-nitro-2,5,12-triazatricyclo[6.3.1.02,6]dodec-6-en-12-amine (PubChem CID 102127232) has the molecular formula C21H22Cl2N6O2 and a molecular weight of 461.35 g/mol. Its IUPAC name is N-(4-chlorophenyl)-5-[(6-chloro-3-pyridinyl)methyl]-7-nitro-2,5,12-triazatricyclo[6.3.1.02,6]dodec-6-en-12-amine.
| Compound Name | N-(4-chlorophenyl)-5-[(6-chloro-3-pyridinyl)methyl]-7-nitro-2,5,12-triazatricyclo[6.3.1.02,6]dodec-6-en-12-amine |
|---|---|
| PubChem CID | 102127232 |
| Molecular Formula | C21H22Cl2N6O2 |
| Molecular Weight | 461.35 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | N-(4-chlorophenyl)-5-[(6-chloro-3-pyridinyl)methyl]-7-nitro-2,5,12-triazatricyclo[6.3.1.02,6]dodec-6-en-12-amine |
| SMILES | O=[N+]([O-])C1=C2N(Cc3ccc(Cl)nc3)CCN2C2CCCC1N2Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H22Cl2N6O2/c22-15-5-7-16(8-6-15)25-28-17-2-1-3-19(28)27-11-10-26(21(27)20(17)29(30)31)13-14-4-9-18(23)24-12-14/h4-9,12,17,19,25H,1-3,10-11,13H2 |
| InChIKey | CWHTZHXCRLQFBP-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 77.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.35 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|