C22H32O10 — CID 102127495
[(4R,7R,8R,9S,10S)-7,10-diacetyloxy-8,9-bis(methoxymethoxy)undec-1-en-5-yn-4-yl] prop-2-enoate (PubChem CID 102127495) has the molecular formula C22H32O10 and a molecular weight of 456.49 g/mol. Its IUPAC name is [(4R,7R,8R,9S,10S)-7,10-diacetyloxy-8,9-bis(methoxymethoxy)undec-1-en-5-yn-4-yl] prop-2-enoate.
| Compound Name | [(4R,7R,8R,9S,10S)-7,10-diacetyloxy-8,9-bis(methoxymethoxy)undec-1-en-5-yn-4-yl] prop-2-enoate |
|---|---|
| PubChem CID | 102127495 |
| Molecular Formula | C22H32O10 |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | [(4R,7R,8R,9S,10S)-7,10-diacetyloxy-8,9-bis(methoxymethoxy)undec-1-en-5-yn-4-yl] prop-2-enoate |
| SMILES | C=CC[C@H](C#C[C@@H](OC(C)=O)[C@@H](OCOC)[C@@H](OCOC)[C@H](C)OC(C)=O)OC(=O)C=C |
| InChI | InChI=1S/C22H32O10/c1-8-10-18(32-20(25)9-2)11-12-19(31-17(5)24)22(29-14-27-7)21(28-13-26-6)15(3)30-16(4)23/h8-9,15,18-19,21-22H,1-2,10,13-14H2,3-7H3/t15-,18+,19+,21-,22+/m0/s1 |
| InChIKey | PQKNGGDWUUVOKF-KMUCGFTESA-N |
| XLogP | 1.53 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|