About 1-acetyl-5,6-bis(4-fluorophenyl)pyridin-2-one
1-acetyl-5,6-bis(4-fluorophenyl)pyridin-2-one (PubChem CID 102127617) has the molecular formula C19H13F2NO2
and a molecular weight of 325.31 g/mol. Its IUPAC name is 1-acetyl-5,6-bis(4-fluorophenyl)pyridin-2-one.
Molecular Properties
| Compound Name | 1-acetyl-5,6-bis(4-fluorophenyl)pyridin-2-one |
| PubChem CID | 102127617 |
| Molecular Formula | C19H13F2NO2 |
| Molecular Weight | 325.31 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 1-acetyl-5,6-bis(4-fluorophenyl)pyridin-2-one |
| SMILES | CC(=O)n1c(-c2ccc(F)cc2)c(-c2ccc(F)cc2)ccc1=O |
| InChI | InChI=1S/C19H13F2NO2/c1-12(23)22-18(24)11-10-17(13-2-6-15(20)7-3-13)19(22)14-4-8-16(21)9-5-14/h2-11H,1H3 |
| InChIKey | OLSOSGBFQPHGOQ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.31 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-acetyl-5,6-bis(4-fluorophenyl)pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-acetyl-5,6-bis(4-fluorophenyl)pyridin-2-one?
The IUPAC name of 1-acetyl-5,6-bis(4-fluorophenyl)pyridin-2-one (CID 102127617) is 1-acetyl-5,6-bis(4-fluorophenyl)pyridin-2-one.
What is the SMILES notation for 1-acetyl-5,6-bis(4-fluorophenyl)pyridin-2-one?
The canonical SMILES for 1-acetyl-5,6-bis(4-fluorophenyl)pyridin-2-one is CC(=O)n1c(-c2ccc(F)cc2)c(-c2ccc(F)cc2)ccc1=O.
What is the InChIKey of 1-acetyl-5,6-bis(4-fluorophenyl)pyridin-2-one?
The InChIKey is OLSOSGBFQPHGOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13F2NO2/c1-12(23)22-18(24)11-10-17(13-2-6-15(20)7-3-13)19(22)14-4-8-16(21)9-5-14/h2-11H,1H3.
What are the key properties of 1-acetyl-5,6-bis(4-fluorophenyl)pyridin-2-one?
1-acetyl-5,6-bis(4-fluorophenyl)pyridin-2-one has a molecular weight of 325.31 g/mol, XLogP of 4.12, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-acetyl-5,6-bis(4-fluorophenyl)pyridin-2-one is sourced from PubChem (CID 102127617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).