C29H46O2 — CID 102127780
(2S,5S,7R,9R,13R,14R)-13-[(2R,5R)-5,6-dimethylheptan-2-yl]-5-hydroxy-2,14-dimethyl-6-methylidenetetracyclo[7.7.1.02,7.014,17]heptadec-1(17)-en-10-one (PubChem CID 102127780) has the molecular formula C29H46O2 and a molecular weight of 426.69 g/mol. Its IUPAC name is (2S,5S,7R,9R,13R,14R)-13-[(2R,5R)-5,6-dimethylheptan-2-yl]-5-hydroxy-2,14-dimethyl-6-methylidenetetracyclo[7.7.1.02,7.014,17]heptadec-1(17)-en-10-one.
| Compound Name | (2S,5S,7R,9R,13R,14R)-13-[(2R,5R)-5,6-dimethylheptan-2-yl]-5-hydroxy-2,14-dimethyl-6-methylidenetetracyclo[7.7.1.02,7.014,17]heptadec-1(17)-en-10-one |
|---|---|
| PubChem CID | 102127780 |
| Molecular Formula | C29H46O2 |
| Molecular Weight | 426.69 g/mol |
| Exact Mass | 426.35 |
| IUPAC Name | (2S,5S,7R,9R,13R,14R)-13-[(2R,5R)-5,6-dimethylheptan-2-yl]-5-hydroxy-2,14-dimethyl-6-methylidenetetracyclo[7.7.1.02,7.014,17]heptadec-1(17)-en-10-one |
| SMILES | C=C1[C@@H](O)CC[C@]2(C)C3=C4[C@@H](C[C@@H]12)C(=O)CC[C@H]([C@H](C)CC[C@@H](C)C(C)C)[C@@]4(C)CC3 |
| InChI | InChI=1S/C29H46O2/c1-17(2)18(3)8-9-19(4)22-10-11-26(31)21-16-24-20(5)25(30)13-15-28(24,6)23-12-14-29(22,7)27(21)23/h17-19,21-22,24-25,30H,5,8-16H2,1-4,6-7H3/t18-,19-,21+,22-,24+,25+,28-,29-/m1/s1 |
| InChIKey | QKIDAKSZXWINRJ-ZGQXDLOVSA-N |
| XLogP | 7.12 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.69 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|