C19H37IO4Si2 — CID 102127984
(4S,5S,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-iodo-6-methoxycyclohex-2-en-1-one (PubChem CID 102127984) has the molecular formula C19H37IO4Si2 and a molecular weight of 512.58 g/mol. Its IUPAC name is (4S,5S,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-iodo-6-methoxycyclohex-2-en-1-one.
| Compound Name | (4S,5S,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-iodo-6-methoxycyclohex-2-en-1-one |
|---|---|
| PubChem CID | 102127984 |
| Molecular Formula | C19H37IO4Si2 |
| Molecular Weight | 512.58 g/mol |
| Exact Mass | 512.13 |
| IUPAC Name | (4S,5S,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-iodo-6-methoxycyclohex-2-en-1-one |
| SMILES | CO[C@@H]1C(=O)C(I)=C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H37IO4Si2/c1-18(2,3)25(8,9)23-14-12-13(20)15(21)17(22-7)16(14)24-26(10,11)19(4,5)6/h12,14,16-17H,1-11H3/t14-,16+,17+/m0/s1 |
| InChIKey | VKOXQVXHVPWZQT-USXIJHARSA-N |
| XLogP | 5.68 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.58 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|