C30H41N7O10 — CID 10212838
2-[4,7-bis(carboxymethyl)-10-[2-[[2-[2-(3-methoxynaphthalene-2-carbonyl)hydrazinyl]-2-oxoethyl]amino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 10212838) has the molecular formula C30H41N7O10 and a molecular weight of 659.70 g/mol. Its IUPAC name is 2-[4,7-bis(carboxymethyl)-10-[2-[[2-[2-(3-methoxynaphthalene-2-carbonyl)hydrazinyl]-2-oxoethyl]amino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4,7-bis(carboxymethyl)-10-[2-[[2-[2-(3-methoxynaphthalene-2-carbonyl)hydrazinyl]-2-oxoethyl]amino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 10212838 |
| Molecular Formula | C30H41N7O10 |
| Molecular Weight | 659.70 g/mol |
| Exact Mass | 659.29 |
| IUPAC Name | 2-[4,7-bis(carboxymethyl)-10-[2-[[2-[2-(3-methoxynaphthalene-2-carbonyl)hydrazinyl]-2-oxoethyl]amino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | COc1cc2ccccc2cc1C(=O)NNC(=O)CNC(=O)CN1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C30H41N7O10/c1-47-24-15-22-5-3-2-4-21(22)14-23(24)30(46)33-32-25(38)16-31-26(39)17-34-6-8-35(18-27(40)41)10-12-37(20-29(44)45)13-11-36(9-7-34)19-28(42)43/h2-5,14-15H,6-13,16-20H2,1H3,(H,31,39)(H,32,38)(H,33,46)(H,40,41)(H,42,43)(H,44,45) |
| InChIKey | SMAOYBUKGDLXDD-UHFFFAOYSA-N |
| XLogP | -1.80 |
| TPSA | 221.39 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.70 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|