C12H27BO2Si — CID 102128834
triethyl-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)silane (PubChem CID 102128834) has the molecular formula C12H27BO2Si and a molecular weight of 242.24 g/mol. Its IUPAC name is triethyl-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)silane.
| Compound Name | triethyl-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)silane |
|---|---|
| PubChem CID | 102128834 |
| Molecular Formula | C12H27BO2Si |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | triethyl-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)silane |
| SMILES | CC[Si](CC)(CC)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C12H27BO2Si/c1-8-16(9-2,10-3)13-14-11(4,5)12(6,7)15-13/h8-10H2,1-7H3 |
| InChIKey | IUQZZPMFYLUYJJ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|