C20H19F3O — CID 102129461
2-[(E)-2-(4-methylphenyl)-2-[4-(trifluoromethyl)phenyl]ethenyl]oxolane (PubChem CID 102129461) has the molecular formula C20H19F3O and a molecular weight of 332.37 g/mol. Its IUPAC name is 2-[(E)-2-(4-methylphenyl)-2-[4-(trifluoromethyl)phenyl]ethenyl]oxolane.
| Compound Name | 2-[(E)-2-(4-methylphenyl)-2-[4-(trifluoromethyl)phenyl]ethenyl]oxolane |
|---|---|
| PubChem CID | 102129461 |
| Molecular Formula | C20H19F3O |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 2-[(E)-2-(4-methylphenyl)-2-[4-(trifluoromethyl)phenyl]ethenyl]oxolane |
| SMILES | Cc1ccc(/C(=C\C2CCCO2)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C20H19F3O/c1-14-4-6-15(7-5-14)19(13-18-3-2-12-24-18)16-8-10-17(11-9-16)20(21,22)23/h4-11,13,18H,2-3,12H2,1H3/b19-13+ |
| InChIKey | NOQGTDLBLWIHKR-CPNJWEJPSA-N |
| XLogP | 5.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |