C23H20ClNO2 — CID 102129670
(1R,2S,6R,7S,8R,10S)-9-(3-chlorophenyl)-4-(4-methylphenyl)-4-azatetracyclo[5.3.1.02,6.08,10]undecane-3,5-dione (PubChem CID 102129670) has the molecular formula C23H20ClNO2 and a molecular weight of 377.87 g/mol. Its IUPAC name is (1R,2S,6R,7S,8R,10S)-9-(3-chlorophenyl)-4-(4-methylphenyl)-4-azatetracyclo[5.3.1.02,6.08,10]undecane-3,5-dione.
| Compound Name | (1R,2S,6R,7S,8R,10S)-9-(3-chlorophenyl)-4-(4-methylphenyl)-4-azatetracyclo[5.3.1.02,6.08,10]undecane-3,5-dione |
|---|---|
| PubChem CID | 102129670 |
| Molecular Formula | C23H20ClNO2 |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | (1R,2S,6R,7S,8R,10S)-9-(3-chlorophenyl)-4-(4-methylphenyl)-4-azatetracyclo[5.3.1.02,6.08,10]undecane-3,5-dione |
| SMILES | Cc1ccc(N2C(=O)[C@@H]3[C@H]4C[C@@H]([C@@H]3C2=O)[C@@H]2C(c3cccc(Cl)c3)[C@H]42)cc1 |
| InChI | InChI=1S/C23H20ClNO2/c1-11-5-7-14(8-6-11)25-22(26)20-15-10-16(21(20)23(25)27)19-17(18(15)19)12-3-2-4-13(24)9-12/h2-9,15-21H,10H2,1H3/t15-,16+,17?,18-,19+,20+,21- |
| InChIKey | TVAJMSARQKKXFU-VCKKMPECSA-N |
| XLogP | 4.43 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|