C38H50O5 — CID 102129927
(1R,3S,4R,5R,7S)-5-benzoyl-4-methyl-1,3,7-tris(3-methylbut-2-enyl)-4-(4-methylpent-3-enyl)-8-oxabicyclo[5.2.1]decane-6,9,10-trione (PubChem CID 102129927) has the molecular formula C38H50O5 and a molecular weight of 586.81 g/mol. Its IUPAC name is (1R,3S,4R,5R,7S)-5-benzoyl-4-methyl-1,3,7-tris(3-methylbut-2-enyl)-4-(4-methylpent-3-enyl)-8-oxabicyclo[5.2.1]decane-6,9,10-trione.
| Compound Name | (1R,3S,4R,5R,7S)-5-benzoyl-4-methyl-1,3,7-tris(3-methylbut-2-enyl)-4-(4-methylpent-3-enyl)-8-oxabicyclo[5.2.1]decane-6,9,10-trione |
|---|---|
| PubChem CID | 102129927 |
| Molecular Formula | C38H50O5 |
| Molecular Weight | 586.81 g/mol |
| Exact Mass | 586.37 |
| IUPAC Name | (1R,3S,4R,5R,7S)-5-benzoyl-4-methyl-1,3,7-tris(3-methylbut-2-enyl)-4-(4-methylpent-3-enyl)-8-oxabicyclo[5.2.1]decane-6,9,10-trione |
| SMILES | CC(C)=CCC[C@]1(C)[C@@H](CC=C(C)C)C[C@@]2(CC=C(C)C)C(=O)O[C@@](CC=C(C)C)(C(=O)[C@H]1C(=O)c1ccccc1)C2=O |
| InChI | InChI=1S/C38H50O5/c1-25(2)14-13-21-36(9)30(18-17-26(3)4)24-37(22-19-27(5)6)34(41)38(43-35(37)42,23-20-28(7)8)33(40)31(36)32(39)29-15-11-10-12-16-29/h10-12,14-17,19-20,30-31H,13,18,21-24H2,1-9H3/t30-,31+,36+,37+,38-/m0/s1 |
| InChIKey | NFHISNLIWYMKGS-IXGDZJQGSA-N |
| XLogP | 8.75 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.81 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|