About (Z)-4-(hydroxymethyl)oct-4-en-2,6-diyne-1,8-diol
(Z)-4-(hydroxymethyl)oct-4-en-2,6-diyne-1,8-diol (PubChem CID 102130046) has the molecular formula C9H10O3
and a molecular weight of 166.18 g/mol. Its IUPAC name is (Z)-4-(hydroxymethyl)oct-4-en-2,6-diyne-1,8-diol.
Molecular Properties
| Compound Name | (Z)-4-(hydroxymethyl)oct-4-en-2,6-diyne-1,8-diol |
| PubChem CID | 102130046 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | (Z)-4-(hydroxymethyl)oct-4-en-2,6-diyne-1,8-diol |
| SMILES | OCC#C/C=C(/C#CCO)CO |
| InChI | InChI=1S/C9H10O3/c10-6-2-1-4-9(8-12)5-3-7-11/h4,10-12H,6-8H2/b9-4- |
| InChIKey | ZTZRWEIGGIVGNC-WTKPLQERSA-N |
| XLogP | -1.10 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-(hydroxymethyl)oct-4-en-2,6-diyne-1,8-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-(hydroxymethyl)oct-4-en-2,6-diyne-1,8-diol?
The IUPAC name of (Z)-4-(hydroxymethyl)oct-4-en-2,6-diyne-1,8-diol (CID 102130046) is (Z)-4-(hydroxymethyl)oct-4-en-2,6-diyne-1,8-diol.
What is the SMILES notation for (Z)-4-(hydroxymethyl)oct-4-en-2,6-diyne-1,8-diol?
The canonical SMILES for (Z)-4-(hydroxymethyl)oct-4-en-2,6-diyne-1,8-diol is OCC#C/C=C(/C#CCO)CO.
What is the InChIKey of (Z)-4-(hydroxymethyl)oct-4-en-2,6-diyne-1,8-diol?
The InChIKey is ZTZRWEIGGIVGNC-WTKPLQERSA-N. The full InChI is InChI=1S/C9H10O3/c10-6-2-1-4-9(8-12)5-3-7-11/h4,10-12H,6-8H2/b9-4-.
What are the key properties of (Z)-4-(hydroxymethyl)oct-4-en-2,6-diyne-1,8-diol?
(Z)-4-(hydroxymethyl)oct-4-en-2,6-diyne-1,8-diol has a molecular weight of 166.18 g/mol, XLogP of -1.10, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-(hydroxymethyl)oct-4-en-2,6-diyne-1,8-diol is sourced from PubChem (CID 102130046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).