About CID 102130139
CID 102130139 (PubChem CID 102130139) has the molecular formula C22H15F3N2O4
and a molecular weight of 428.37 g/mol.
Molecular Properties
| Compound Name | CID 102130139 |
| PubChem CID | 102130139 |
| Molecular Formula | C22H15F3N2O4 |
| Molecular Weight | 428.37 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | — |
| SMILES | CN1C(=O)C2(C(C=O)=COC23C(=O)N(C)c2c(C(F)(F)F)cccc23)c2ccccc21 |
| InChI | InChI=1S/C22H15F3N2O4/c1-26-16-9-4-3-6-13(16)20(18(26)29)12(10-28)11-31-21(20)14-7-5-8-15(22(23,24)25)17(14)27(2)19(21)30/h3-11H,1-2H3 |
| InChIKey | OXGBUBSXXPVZNC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze CID 102130139 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102130139?
The IUPAC name of CID 102130139 (CID 102130139) is not available.
What is the SMILES notation for CID 102130139?
The canonical SMILES for CID 102130139 is CN1C(=O)C2(C(C=O)=COC23C(=O)N(C)c2c(C(F)(F)F)cccc23)c2ccccc21.
What is the InChIKey of CID 102130139?
The InChIKey is OXGBUBSXXPVZNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15F3N2O4/c1-26-16-9-4-3-6-13(16)20(18(26)29)12(10-28)11-31-21(20)14-7-5-8-15(22(23,24)25)17(14)27(2)19(21)30/h3-11H,1-2H3.
What are the key properties of CID 102130139?
CID 102130139 has a molecular weight of 428.37 g/mol, XLogP of 2.90, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102130139 is sourced from PubChem (CID 102130139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).