C21H19Cl2N3O3 — CID 102130649
(6S)-2,3-dichloro-9,9-dimethyl-6-(4-nitrophenyl)-6,8,10,11-tetrahydro-5H-benzo[b][1,4]benzodiazepin-7-one (PubChem CID 102130649) has the molecular formula C21H19Cl2N3O3 and a molecular weight of 432.31 g/mol. Its IUPAC name is (6S)-2,3-dichloro-9,9-dimethyl-6-(4-nitrophenyl)-6,8,10,11-tetrahydro-5H-benzo[b][1,4]benzodiazepin-7-one.
| Compound Name | (6S)-2,3-dichloro-9,9-dimethyl-6-(4-nitrophenyl)-6,8,10,11-tetrahydro-5H-benzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 102130649 |
| Molecular Formula | C21H19Cl2N3O3 |
| Molecular Weight | 432.31 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | (6S)-2,3-dichloro-9,9-dimethyl-6-(4-nitrophenyl)-6,8,10,11-tetrahydro-5H-benzo[b][1,4]benzodiazepin-7-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1cc(Cl)c(Cl)cc1N[C@H]2c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H19Cl2N3O3/c1-21(2)9-17-19(18(27)10-21)20(11-3-5-12(6-4-11)26(28)29)25-16-8-14(23)13(22)7-15(16)24-17/h3-8,20,24-25H,9-10H2,1-2H3/t20-/m0/s1 |
| InChIKey | JCCOYNGFHCMHSA-FQEVSTJZSA-N |
| XLogP | 6.12 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.31 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|