About tert-butyl 2-[(1S,5R)-1-methyl-2-oxo-5-pentylcyclopentyl]acetate
tert-butyl 2-[(1S,5R)-1-methyl-2-oxo-5-pentylcyclopentyl]acetate (PubChem CID 102130667) has the molecular formula C17H30O3
and a molecular weight of 282.42 g/mol. Its IUPAC name is tert-butyl 2-[(1S,5R)-1-methyl-2-oxo-5-pentylcyclopentyl]acetate.
Molecular Properties
| Compound Name | tert-butyl 2-[(1S,5R)-1-methyl-2-oxo-5-pentylcyclopentyl]acetate |
| PubChem CID | 102130667 |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | tert-butyl 2-[(1S,5R)-1-methyl-2-oxo-5-pentylcyclopentyl]acetate |
| SMILES | CCCCC[C@@H]1CCC(=O)[C@@]1(C)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H30O3/c1-6-7-8-9-13-10-11-14(18)17(13,5)12-15(19)20-16(2,3)4/h13H,6-12H2,1-5H3/t13-,17+/m1/s1 |
| InChIKey | BBORGGWJIBAVGE-DYVFJYSZSA-N |
| XLogP | 4.28 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-[(1S,5R)-1-methyl-2-oxo-5-pentylcyclopentyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[(1S,5R)-1-methyl-2-oxo-5-pentylcyclopentyl]acetate?
The IUPAC name of tert-butyl 2-[(1S,5R)-1-methyl-2-oxo-5-pentylcyclopentyl]acetate (CID 102130667) is tert-butyl 2-[(1S,5R)-1-methyl-2-oxo-5-pentylcyclopentyl]acetate.
What is the SMILES notation for tert-butyl 2-[(1S,5R)-1-methyl-2-oxo-5-pentylcyclopentyl]acetate?
The canonical SMILES for tert-butyl 2-[(1S,5R)-1-methyl-2-oxo-5-pentylcyclopentyl]acetate is CCCCC[C@@H]1CCC(=O)[C@@]1(C)CC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 2-[(1S,5R)-1-methyl-2-oxo-5-pentylcyclopentyl]acetate?
The InChIKey is BBORGGWJIBAVGE-DYVFJYSZSA-N. The full InChI is InChI=1S/C17H30O3/c1-6-7-8-9-13-10-11-14(18)17(13,5)12-15(19)20-16(2,3)4/h13H,6-12H2,1-5H3/t13-,17+/m1/s1.
What are the key properties of tert-butyl 2-[(1S,5R)-1-methyl-2-oxo-5-pentylcyclopentyl]acetate?
tert-butyl 2-[(1S,5R)-1-methyl-2-oxo-5-pentylcyclopentyl]acetate has a molecular weight of 282.42 g/mol, XLogP of 4.28, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[(1S,5R)-1-methyl-2-oxo-5-pentylcyclopentyl]acetate is sourced from PubChem (CID 102130667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).