C22H36O3 — CID 102130906
(5S)-5-[(1R,4E,8E)-1-hydroxy-5,9,13-trimethyltetradeca-4,8,12-trienyl]-5-methyloxolan-2-one (PubChem CID 102130906) has the molecular formula C22H36O3 and a molecular weight of 348.53 g/mol. Its IUPAC name is (5S)-5-[(1R,4E,8E)-1-hydroxy-5,9,13-trimethyltetradeca-4,8,12-trienyl]-5-methyloxolan-2-one.
| Compound Name | (5S)-5-[(1R,4E,8E)-1-hydroxy-5,9,13-trimethyltetradeca-4,8,12-trienyl]-5-methyloxolan-2-one |
|---|---|
| PubChem CID | 102130906 |
| Molecular Formula | C22H36O3 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.27 |
| IUPAC Name | (5S)-5-[(1R,4E,8E)-1-hydroxy-5,9,13-trimethyltetradeca-4,8,12-trienyl]-5-methyloxolan-2-one |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC[C@@H](O)[C@]1(C)CCC(=O)O1 |
| InChI | InChI=1S/C22H36O3/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(23)22(5)16-15-21(24)25-22/h9,11,13,20,23H,6-8,10,12,14-16H2,1-5H3/b18-11+,19-13+/t20-,22+/m1/s1 |
| InChIKey | FMCVIMRVTTZJJB-HXNVHFGHSA-N |
| XLogP | 5.64 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|