C22H42O4Si — CID 102130930
ethyl 2-[(1S,2S,5S,6S)-2-formyl-2,6-dimethyl-5-tri(propan-2-yl)silyloxycyclohexyl]acetate (PubChem CID 102130930) has the molecular formula C22H42O4Si and a molecular weight of 398.66 g/mol. Its IUPAC name is ethyl 2-[(1S,2S,5S,6S)-2-formyl-2,6-dimethyl-5-tri(propan-2-yl)silyloxycyclohexyl]acetate.
| Compound Name | ethyl 2-[(1S,2S,5S,6S)-2-formyl-2,6-dimethyl-5-tri(propan-2-yl)silyloxycyclohexyl]acetate |
|---|---|
| PubChem CID | 102130930 |
| Molecular Formula | C22H42O4Si |
| Molecular Weight | 398.66 g/mol |
| Exact Mass | 398.29 |
| IUPAC Name | ethyl 2-[(1S,2S,5S,6S)-2-formyl-2,6-dimethyl-5-tri(propan-2-yl)silyloxycyclohexyl]acetate |
| SMILES | CCOC(=O)C[C@H]1[C@H](C)[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)CC[C@]1(C)C=O |
| InChI | InChI=1S/C22H42O4Si/c1-10-25-21(24)13-19-18(8)20(11-12-22(19,9)14-23)26-27(15(2)3,16(4)5)17(6)7/h14-20H,10-13H2,1-9H3/t18-,19-,20-,22+/m0/s1 |
| InChIKey | ANMMUXONTXZESP-BPBCIEFSSA-N |
| XLogP | 5.75 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.66 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|