C9H4F4O4 — CID 102131175
2-(carboxymethyl)-3,4,5,6-tetrafluorobenzoic acid (PubChem CID 102131175) has the molecular formula C9H4F4O4 and a molecular weight of 252.12 g/mol. Its IUPAC name is 2-(carboxymethyl)-3,4,5,6-tetrafluorobenzoic acid.
| Compound Name | 2-(carboxymethyl)-3,4,5,6-tetrafluorobenzoic acid |
|---|---|
| PubChem CID | 102131175 |
| Molecular Formula | C9H4F4O4 |
| Molecular Weight | 252.12 g/mol |
| Exact Mass | 252.00 |
| IUPAC Name | 2-(carboxymethyl)-3,4,5,6-tetrafluorobenzoic acid |
| SMILES | O=C(O)Cc1c(F)c(F)c(F)c(F)c1C(=O)O |
| InChI | InChI=1S/C9H4F4O4/c10-5-2(1-3(14)15)4(9(16)17)6(11)8(13)7(5)12/h1H2,(H,14,15)(H,16,17) |
| InChIKey | FVYQTUHLKLFKAR-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.12 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|