C12H16N2O3 — CID 102132003
1-(2,2-dimethyl-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxin-6-yl)imidazole (PubChem CID 102132003) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is 1-(2,2-dimethyl-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxin-6-yl)imidazole.
| Compound Name | 1-(2,2-dimethyl-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxin-6-yl)imidazole |
|---|---|
| PubChem CID | 102132003 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 1-(2,2-dimethyl-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxin-6-yl)imidazole |
| SMILES | CC1(C)OCC2OC(n3ccnc3)C=CC2O1 |
| InChI | InChI=1S/C12H16N2O3/c1-12(2)15-7-10-9(17-12)3-4-11(16-10)14-6-5-13-8-14/h3-6,8-11H,7H2,1-2H3 |
| InChIKey | MRWRQGHIOHFMNF-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|