C18H28N2O3 — CID 102132006
1-(2,2-ditert-butyl-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxin-6-yl)imidazole (PubChem CID 102132006) has the molecular formula C18H28N2O3 and a molecular weight of 320.43 g/mol. Its IUPAC name is 1-(2,2-ditert-butyl-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxin-6-yl)imidazole.
| Compound Name | 1-(2,2-ditert-butyl-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxin-6-yl)imidazole |
|---|---|
| PubChem CID | 102132006 |
| Molecular Formula | C18H28N2O3 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | 1-(2,2-ditert-butyl-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxin-6-yl)imidazole |
| SMILES | CC(C)(C)C1(C(C)(C)C)OCC2OC(n3ccnc3)C=CC2O1 |
| InChI | InChI=1S/C18H28N2O3/c1-16(2,3)18(17(4,5)6)21-11-14-13(23-18)7-8-15(22-14)20-10-9-19-12-20/h7-10,12-15H,11H2,1-6H3 |
| InChIKey | CKEGGPLZKBCOBQ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|