About (5R,10R)-10-prop-2-ynylspiro[4.5]decane-4,9-dione
(5R,10R)-10-prop-2-ynylspiro[4.5]decane-4,9-dione (PubChem CID 102132299) has the molecular formula C13H16O2
and a molecular weight of 204.27 g/mol. Its IUPAC name is (5R,10R)-10-prop-2-ynylspiro[4.5]decane-4,9-dione.
Molecular Properties
| Compound Name | (5R,10R)-10-prop-2-ynylspiro[4.5]decane-4,9-dione |
| PubChem CID | 102132299 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | (5R,10R)-10-prop-2-ynylspiro[4.5]decane-4,9-dione |
| SMILES | C#CC[C@H]1C(=O)CCC[C@]12CCCC2=O |
| InChI | InChI=1S/C13H16O2/c1-2-5-10-11(14)6-3-8-13(10)9-4-7-12(13)15/h1,10H,3-9H2/t10-,13-/m0/s1 |
| InChIKey | VDMMTUPONFWUHG-GWCFXTLKSA-N |
| XLogP | 2.12 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (5R,10R)-10-prop-2-ynylspiro[4.5]decane-4,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R,10R)-10-prop-2-ynylspiro[4.5]decane-4,9-dione?
The IUPAC name of (5R,10R)-10-prop-2-ynylspiro[4.5]decane-4,9-dione (CID 102132299) is (5R,10R)-10-prop-2-ynylspiro[4.5]decane-4,9-dione.
What is the SMILES notation for (5R,10R)-10-prop-2-ynylspiro[4.5]decane-4,9-dione?
The canonical SMILES for (5R,10R)-10-prop-2-ynylspiro[4.5]decane-4,9-dione is C#CC[C@H]1C(=O)CCC[C@]12CCCC2=O.
What is the InChIKey of (5R,10R)-10-prop-2-ynylspiro[4.5]decane-4,9-dione?
The InChIKey is VDMMTUPONFWUHG-GWCFXTLKSA-N. The full InChI is InChI=1S/C13H16O2/c1-2-5-10-11(14)6-3-8-13(10)9-4-7-12(13)15/h1,10H,3-9H2/t10-,13-/m0/s1.
What are the key properties of (5R,10R)-10-prop-2-ynylspiro[4.5]decane-4,9-dione?
(5R,10R)-10-prop-2-ynylspiro[4.5]decane-4,9-dione has a molecular weight of 204.27 g/mol, XLogP of 2.12, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5R,10R)-10-prop-2-ynylspiro[4.5]decane-4,9-dione is sourced from PubChem (CID 102132299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).