About CID 102132526
CID 102132526 (PubChem CID 102132526) has the molecular formula C17H22O6
and a molecular weight of 322.36 g/mol.
Molecular Properties
| Compound Name | CID 102132526 |
| PubChem CID | 102132526 |
| Molecular Formula | C17H22O6 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | — |
| SMILES | COC(=O)C[C@@H]1C[C@H]2OC3(C=CC4(CC=CCO4)O3)CC[C@H]2O1 |
| InChI | InChI=1S/C17H22O6/c1-19-15(18)11-12-10-14-13(21-12)4-6-17(22-14)8-7-16(23-17)5-2-3-9-20-16/h2-3,7-8,12-14H,4-6,9-11H2,1H3/t12-,13+,14+,16?,17?/m0/s1 |
| InChIKey | JBTAVNZSGFLDGB-RJQUXWJSSA-N |
| XLogP | 1.84 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_misc_A(5)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 102132526 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102132526?
The IUPAC name of CID 102132526 (CID 102132526) is not available.
What is the SMILES notation for CID 102132526?
The canonical SMILES for CID 102132526 is COC(=O)C[C@@H]1C[C@H]2OC3(C=CC4(CC=CCO4)O3)CC[C@H]2O1.
What is the InChIKey of CID 102132526?
The InChIKey is JBTAVNZSGFLDGB-RJQUXWJSSA-N. The full InChI is InChI=1S/C17H22O6/c1-19-15(18)11-12-10-14-13(21-12)4-6-17(22-14)8-7-16(23-17)5-2-3-9-20-16/h2-3,7-8,12-14H,4-6,9-11H2,1H3/t12-,13+,14+,16?,17?/m0/s1.
What are the key properties of CID 102132526?
CID 102132526 has a molecular weight of 322.36 g/mol, XLogP of 1.84, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102132526 is sourced from PubChem (CID 102132526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).