C9H4F12N2S2 — CID 102132702
1-[1,1,1,3,3,3-hexafluoro-2-(1,1,1,3,3,3-hexafluoropropan-2-yldisulfanyl)propan-2-yl]pyrazole (PubChem CID 102132702) has the molecular formula C9H4F12N2S2 and a molecular weight of 432.26 g/mol. Its IUPAC name is 1-[1,1,1,3,3,3-hexafluoro-2-(1,1,1,3,3,3-hexafluoropropan-2-yldisulfanyl)propan-2-yl]pyrazole.
| Compound Name | 1-[1,1,1,3,3,3-hexafluoro-2-(1,1,1,3,3,3-hexafluoropropan-2-yldisulfanyl)propan-2-yl]pyrazole |
|---|---|
| PubChem CID | 102132702 |
| Molecular Formula | C9H4F12N2S2 |
| Molecular Weight | 432.26 g/mol |
| Exact Mass | 431.96 |
| IUPAC Name | 1-[1,1,1,3,3,3-hexafluoro-2-(1,1,1,3,3,3-hexafluoropropan-2-yldisulfanyl)propan-2-yl]pyrazole |
| SMILES | FC(F)(F)C(SSC(n1cccn1)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H4F12N2S2/c10-5(11,12)4(6(13,14)15)24-25-7(8(16,17)18,9(19,20)21)23-3-1-2-22-23/h1-4H |
| InChIKey | KUEBJZYRORVDQH-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.26 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|