C30H24O12 — CID 102132733
(1R,5S,6R,12R,20S)-5-(3,4-dihydroxyphenyl)-12-(3,4,5-trihydroxyphenyl)-4,13-dioxapentacyclo[10.7.1.02,11.03,8.014,19]icosa-2,8,10,14,16,18-hexaene-6,9,16,18,20-pentol (PubChem CID 102132733) has the molecular formula C30H24O12 and a molecular weight of 576.51 g/mol. Its IUPAC name is (1R,5S,6R,12R,20S)-5-(3,4-dihydroxyphenyl)-12-(3,4,5-trihydroxyphenyl)-4,13-dioxapentacyclo[10.7.1.02,11.03,8.014,19]icosa-2,8,10,14,16,18-hexaene-6,9,16,18,20-pentol.
| Compound Name | (1R,5S,6R,12R,20S)-5-(3,4-dihydroxyphenyl)-12-(3,4,5-trihydroxyphenyl)-4,13-dioxapentacyclo[10.7.1.02,11.03,8.014,19]icosa-2,8,10,14,16,18-hexaene-6,9,16,18,20-pentol |
|---|---|
| PubChem CID | 102132733 |
| Molecular Formula | C30H24O12 |
| Molecular Weight | 576.51 g/mol |
| Exact Mass | 576.13 |
| IUPAC Name | (1R,5S,6R,12R,20S)-5-(3,4-dihydroxyphenyl)-12-(3,4,5-trihydroxyphenyl)-4,13-dioxapentacyclo[10.7.1.02,11.03,8.014,19]icosa-2,8,10,14,16,18-hexaene-6,9,16,18,20-pentol |
| SMILES | Oc1cc(O)c2c(c1)O[C@]1(c3cc(O)c(O)c(O)c3)c3cc(O)c4c(c3[C@H]2[C@@H]1O)O[C@@H](c1ccc(O)c(O)c1)[C@H](O)C4 |
| InChI | InChI=1S/C30H24O12/c31-12-6-18(35)24-22(7-12)42-30(11-4-19(36)26(39)20(37)5-11)14-9-16(33)13-8-21(38)27(10-1-2-15(32)17(34)3-10)41-28(13)23(14)25(24)29(30)40/h1-7,9,21,25,27,29,31-40H,8H2/t21-,25-,27+,29+,30-/m1/s1 |
| InChIKey | VEHQWYPRFMLMEW-IUJCLXNHSA-N |
| XLogP | 2.51 |
| TPSA | 220.76 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.51 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|