C16H29N — CID 102132768
9-butyl-1,2,3,4,4a,4b,5,6,7,8,8a,9a-dodecahydrocarbazole (PubChem CID 102132768) has the molecular formula C16H29N and a molecular weight of 235.41 g/mol. Its IUPAC name is 9-butyl-1,2,3,4,4a,4b,5,6,7,8,8a,9a-dodecahydrocarbazole.
| Compound Name | 9-butyl-1,2,3,4,4a,4b,5,6,7,8,8a,9a-dodecahydrocarbazole |
|---|---|
| PubChem CID | 102132768 |
| Molecular Formula | C16H29N |
| Molecular Weight | 235.41 g/mol |
| Exact Mass | 235.23 |
| IUPAC Name | 9-butyl-1,2,3,4,4a,4b,5,6,7,8,8a,9a-dodecahydrocarbazole |
| SMILES | CCCCN1C2CCCCC2C2CCCCC21 |
| InChI | InChI=1S/C16H29N/c1-2-3-12-17-15-10-6-4-8-13(15)14-9-5-7-11-16(14)17/h13-16H,2-12H2,1H3 |
| InChIKey | ZXZHBAFJRJGZJJ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.41 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |