C24H38O11 — CID 102133428
(E)-4-[4-[(2R,3R,4S,5S,6R)-6-[[(3R,4S)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-2,6,6-trimethylcyclohexen-1-yl]but-3-en-2-one (PubChem CID 102133428) has the molecular formula C24H38O11 and a molecular weight of 502.56 g/mol. Its IUPAC name is (E)-4-[4-[(2R,3R,4S,5S,6R)-6-[[(3R,4S)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-2,6,6-trimethylcyclohexen-1-yl]but-3-en-2-one.
| Compound Name | (E)-4-[4-[(2R,3R,4S,5S,6R)-6-[[(3R,4S)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-2,6,6-trimethylcyclohexen-1-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 102133428 |
| Molecular Formula | C24H38O11 |
| Molecular Weight | 502.56 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | (E)-4-[4-[(2R,3R,4S,5S,6R)-6-[[(3R,4S)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-2,6,6-trimethylcyclohexen-1-yl]but-3-en-2-one |
| SMILES | CC(=O)/C=C/C1=C(C)CC(O[C@@H]2O[C@H](COC3OC[C@@](O)(CO)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)CC1(C)C |
| InChI | InChI=1S/C24H38O11/c1-12-7-14(8-23(3,4)15(12)6-5-13(2)26)34-21-19(29)18(28)17(27)16(35-21)9-32-22-20(30)24(31,10-25)11-33-22/h5-6,14,16-22,25,27-31H,7-11H2,1-4H3/b6-5+/t14?,16-,17-,18+,19-,20+,21-,22?,24+/m1/s1 |
| InChIKey | RKLRNJVOTIMZFP-IYKYJKHOSA-N |
| XLogP | -1.08 |
| TPSA | 175.37 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.56 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|