C25H33ClO5 — CID 102133626
1-chloro-3-[4-[3-[4-(2,3-dihydroxypropoxy)-3-methylphenyl]pentan-3-yl]-2-methylphenoxy]propan-2-one (PubChem CID 102133626) has the molecular formula C25H33ClO5 and a molecular weight of 448.99 g/mol. Its IUPAC name is 1-chloro-3-[4-[3-[4-(2,3-dihydroxypropoxy)-3-methylphenyl]pentan-3-yl]-2-methylphenoxy]propan-2-one.
| Compound Name | 1-chloro-3-[4-[3-[4-(2,3-dihydroxypropoxy)-3-methylphenyl]pentan-3-yl]-2-methylphenoxy]propan-2-one |
|---|---|
| PubChem CID | 102133626 |
| Molecular Formula | C25H33ClO5 |
| Molecular Weight | 448.99 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 1-chloro-3-[4-[3-[4-(2,3-dihydroxypropoxy)-3-methylphenyl]pentan-3-yl]-2-methylphenoxy]propan-2-one |
| SMILES | CCC(CC)(c1ccc(OCC(=O)CCl)c(C)c1)c1ccc(OCC(O)CO)c(C)c1 |
| InChI | InChI=1S/C25H33ClO5/c1-5-25(6-2,19-7-9-23(17(3)11-19)30-15-21(28)13-26)20-8-10-24(18(4)12-20)31-16-22(29)14-27/h7-12,22,27,29H,5-6,13-16H2,1-4H3 |
| InChIKey | DKFYQHJRYOJODS-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.99 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|