C25H39N — CID 102134296
(3E,5E,7E,9E)-N-butyl-4,8-dimethyl-10-(2,6,6-trimethylcyclohexen-1-yl)deca-3,5,7,9-tetraen-2-imine (PubChem CID 102134296) has the molecular formula C25H39N and a molecular weight of 353.59 g/mol. Its IUPAC name is (3E,5E,7E,9E)-N-butyl-4,8-dimethyl-10-(2,6,6-trimethylcyclohexen-1-yl)deca-3,5,7,9-tetraen-2-imine.
| Compound Name | (3E,5E,7E,9E)-N-butyl-4,8-dimethyl-10-(2,6,6-trimethylcyclohexen-1-yl)deca-3,5,7,9-tetraen-2-imine |
|---|---|
| PubChem CID | 102134296 |
| Molecular Formula | C25H39N |
| Molecular Weight | 353.59 g/mol |
| Exact Mass | 353.31 |
| IUPAC Name | (3E,5E,7E,9E)-N-butyl-4,8-dimethyl-10-(2,6,6-trimethylcyclohexen-1-yl)deca-3,5,7,9-tetraen-2-imine |
| SMILES | CCCC/N=C(C)/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C25H39N/c1-8-9-18-26-23(5)19-21(3)13-10-12-20(2)15-16-24-22(4)14-11-17-25(24,6)7/h10,12-13,15-16,19H,8-9,11,14,17-18H2,1-7H3/b13-10+,16-15+,20-12+,21-19+,26-23+ |
| InChIKey | CGJGHNMVPJYHPH-PTCATPILSA-N |
| XLogP | 7.78 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.59 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|