About CID 102134405
CID 102134405 (PubChem CID 102134405) has the molecular formula C14H27N2O2
and a molecular weight of 255.38 g/mol.
Molecular Properties
| Compound Name | CID 102134405 |
| PubChem CID | 102134405 |
| Molecular Formula | C14H27N2O2 |
| Molecular Weight | 255.38 g/mol |
| Exact Mass | 255.21 |
| IUPAC Name | — |
| SMILES | CC(C)(C)C(=O)NC1CC(C)(C)N([O])C(C)(C)C1 |
| InChI | InChI=1S/C14H27N2O2/c1-12(2,3)11(17)15-10-8-13(4,5)16(18)14(6,7)9-10/h10H,8-9H2,1-7H3,(H,15,17) |
| InChIKey | KBXBZNWQMJCXEB-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 52.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 102134405 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102134405?
The IUPAC name of CID 102134405 (CID 102134405) is not available.
What is the SMILES notation for CID 102134405?
The canonical SMILES for CID 102134405 is CC(C)(C)C(=O)NC1CC(C)(C)N([O])C(C)(C)C1.
What is the InChIKey of CID 102134405?
The InChIKey is KBXBZNWQMJCXEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27N2O2/c1-12(2,3)11(17)15-10-8-13(4,5)16(18)14(6,7)9-10/h10H,8-9H2,1-7H3,(H,15,17).
What are the key properties of CID 102134405?
CID 102134405 has a molecular weight of 255.38 g/mol, XLogP of 2.52, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102134405 is sourced from PubChem (CID 102134405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).