C25H23N3O5S — CID 102134771
5-(4-methoxyphenyl)-2-(4-nitrophenyl)sulfonyl-3,4,5,6-tetrahydro-1H-azepino[4,3-b]indole (PubChem CID 102134771) has the molecular formula C25H23N3O5S and a molecular weight of 477.54 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-2-(4-nitrophenyl)sulfonyl-3,4,5,6-tetrahydro-1H-azepino[4,3-b]indole.
| Compound Name | 5-(4-methoxyphenyl)-2-(4-nitrophenyl)sulfonyl-3,4,5,6-tetrahydro-1H-azepino[4,3-b]indole |
|---|---|
| PubChem CID | 102134771 |
| Molecular Formula | C25H23N3O5S |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | 5-(4-methoxyphenyl)-2-(4-nitrophenyl)sulfonyl-3,4,5,6-tetrahydro-1H-azepino[4,3-b]indole |
| SMILES | COc1ccc(C2CCN(S(=O)(=O)c3ccc([N+](=O)[O-])cc3)Cc3c2[nH]c2ccccc32)cc1 |
| InChI | InChI=1S/C25H23N3O5S/c1-33-19-10-6-17(7-11-19)21-14-15-27(16-23-22-4-2-3-5-24(22)26-25(21)23)34(31,32)20-12-8-18(9-13-20)28(29)30/h2-13,21,26H,14-16H2,1H3 |
| InChIKey | HMWPDCDIIWBOHR-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 105.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|