About 6-[(E)-4,5-dihydroxyhex-2-en-2-yl]-4-methoxy-3-methylpyran-2-one
6-[(E)-4,5-dihydroxyhex-2-en-2-yl]-4-methoxy-3-methylpyran-2-one (PubChem CID 102134982) has the molecular formula C13H18O5
and a molecular weight of 254.28 g/mol. Its IUPAC name is 6-[(E)-4,5-dihydroxyhex-2-en-2-yl]-4-methoxy-3-methylpyran-2-one.
Molecular Properties
| Compound Name | 6-[(E)-4,5-dihydroxyhex-2-en-2-yl]-4-methoxy-3-methylpyran-2-one |
| PubChem CID | 102134982 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 6-[(E)-4,5-dihydroxyhex-2-en-2-yl]-4-methoxy-3-methylpyran-2-one |
| SMILES | COc1cc(/C(C)=C/C(O)C(C)O)oc(=O)c1C |
| InChI | InChI=1S/C13H18O5/c1-7(5-10(15)9(3)14)11-6-12(17-4)8(2)13(16)18-11/h5-6,9-10,14-15H,1-4H3/b7-5+ |
| InChIKey | AFUDNHIBDYALNP-FNORWQNLSA-N |
| XLogP | 1.10 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[(E)-4,5-dihydroxyhex-2-en-2-yl]-4-methoxy-3-methylpyran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(E)-4,5-dihydroxyhex-2-en-2-yl]-4-methoxy-3-methylpyran-2-one?
The IUPAC name of 6-[(E)-4,5-dihydroxyhex-2-en-2-yl]-4-methoxy-3-methylpyran-2-one (CID 102134982) is 6-[(E)-4,5-dihydroxyhex-2-en-2-yl]-4-methoxy-3-methylpyran-2-one.
What is the SMILES notation for 6-[(E)-4,5-dihydroxyhex-2-en-2-yl]-4-methoxy-3-methylpyran-2-one?
The canonical SMILES for 6-[(E)-4,5-dihydroxyhex-2-en-2-yl]-4-methoxy-3-methylpyran-2-one is COc1cc(/C(C)=C/C(O)C(C)O)oc(=O)c1C.
What is the InChIKey of 6-[(E)-4,5-dihydroxyhex-2-en-2-yl]-4-methoxy-3-methylpyran-2-one?
The InChIKey is AFUDNHIBDYALNP-FNORWQNLSA-N. The full InChI is InChI=1S/C13H18O5/c1-7(5-10(15)9(3)14)11-6-12(17-4)8(2)13(16)18-11/h5-6,9-10,14-15H,1-4H3/b7-5+.
What are the key properties of 6-[(E)-4,5-dihydroxyhex-2-en-2-yl]-4-methoxy-3-methylpyran-2-one?
6-[(E)-4,5-dihydroxyhex-2-en-2-yl]-4-methoxy-3-methylpyran-2-one has a molecular weight of 254.28 g/mol, XLogP of 1.10, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(E)-4,5-dihydroxyhex-2-en-2-yl]-4-methoxy-3-methylpyran-2-one is sourced from PubChem (CID 102134982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).