C23H44O4Si2 — CID 102135002
(2E,5S,7R)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4-oxoundeca-2,10-dienal (PubChem CID 102135002) has the molecular formula C23H44O4Si2 and a molecular weight of 440.77 g/mol. Its IUPAC name is (2E,5S,7R)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4-oxoundeca-2,10-dienal.
| Compound Name | (2E,5S,7R)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4-oxoundeca-2,10-dienal |
|---|---|
| PubChem CID | 102135002 |
| Molecular Formula | C23H44O4Si2 |
| Molecular Weight | 440.77 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | (2E,5S,7R)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4-oxoundeca-2,10-dienal |
| SMILES | C=CCC[C@H](C[C@H](O[Si](C)(C)C(C)(C)C)C(=O)/C=C/C=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H44O4Si2/c1-12-13-15-19(26-28(8,9)22(2,3)4)18-21(20(25)16-14-17-24)27-29(10,11)23(5,6)7/h12,14,16-17,19,21H,1,13,15,18H2,2-11H3/b16-14+/t19-,21+/m1/s1 |
| InChIKey | PAIKCDFLSWVJFZ-ODKDEZGZSA-N |
| XLogP | 6.45 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.77 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|