C23H44O5Si2 — CID 102135003
(2E,5S,7R)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4-oxoundeca-2,10-dienoic acid (PubChem CID 102135003) has the molecular formula C23H44O5Si2 and a molecular weight of 456.77 g/mol. Its IUPAC name is (2E,5S,7R)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4-oxoundeca-2,10-dienoic acid.
| Compound Name | (2E,5S,7R)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4-oxoundeca-2,10-dienoic acid |
|---|---|
| PubChem CID | 102135003 |
| Molecular Formula | C23H44O5Si2 |
| Molecular Weight | 456.77 g/mol |
| Exact Mass | 456.27 |
| IUPAC Name | (2E,5S,7R)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4-oxoundeca-2,10-dienoic acid |
| SMILES | C=CCC[C@H](C[C@H](O[Si](C)(C)C(C)(C)C)C(=O)/C=C/C(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H44O5Si2/c1-12-13-14-18(27-29(8,9)22(2,3)4)17-20(19(24)15-16-21(25)26)28-30(10,11)23(5,6)7/h12,15-16,18,20H,1,13-14,17H2,2-11H3,(H,25,26)/b16-15+/t18-,20+/m1/s1 |
| InChIKey | NTSMJEWENZCEEK-JAFFASMWSA-N |
| XLogP | 6.33 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.77 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|