C20H27FN2O — CID 102135350
[1-(5-fluoropentyl)indazol-3-yl]-(2,2,3,3-tetramethylcyclopropyl)methanone (PubChem CID 102135350) has the molecular formula C20H27FN2O and a molecular weight of 330.45 g/mol. Its IUPAC name is [1-(5-fluoropentyl)indazol-3-yl]-(2,2,3,3-tetramethylcyclopropyl)methanone.
| Compound Name | [1-(5-fluoropentyl)indazol-3-yl]-(2,2,3,3-tetramethylcyclopropyl)methanone |
|---|---|
| PubChem CID | 102135350 |
| Molecular Formula | C20H27FN2O |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | [1-(5-fluoropentyl)indazol-3-yl]-(2,2,3,3-tetramethylcyclopropyl)methanone |
| SMILES | CC1(C)C(C(=O)c2nn(CCCCCF)c3ccccc23)C1(C)C |
| InChI | InChI=1S/C20H27FN2O/c1-19(2)18(20(19,3)4)17(24)16-14-10-6-7-11-15(14)23(22-16)13-9-5-8-12-21/h6-7,10-11,18H,5,8-9,12-13H2,1-4H3 |
| InChIKey | LVJQJRUAYXVEGN-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|