About 5-(2-methoxy-1,3-dithian-2-yl)pyrrolidin-2-one
5-(2-methoxy-1,3-dithian-2-yl)pyrrolidin-2-one (PubChem CID 102136140) has the molecular formula C9H15NO2S2
and a molecular weight of 233.36 g/mol. Its IUPAC name is 5-(2-methoxy-1,3-dithian-2-yl)pyrrolidin-2-one.
Molecular Properties
| Compound Name | 5-(2-methoxy-1,3-dithian-2-yl)pyrrolidin-2-one |
| PubChem CID | 102136140 |
| Molecular Formula | C9H15NO2S2 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | 5-(2-methoxy-1,3-dithian-2-yl)pyrrolidin-2-one |
| SMILES | COC1(C2CCC(=O)N2)SCCCS1 |
| InChI | InChI=1S/C9H15NO2S2/c1-12-9(13-5-2-6-14-9)7-3-4-8(11)10-7/h7H,2-6H2,1H3,(H,10,11) |
| InChIKey | BVAMZSHHXCUPKE-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(2-methoxy-1,3-dithian-2-yl)pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-methoxy-1,3-dithian-2-yl)pyrrolidin-2-one?
The IUPAC name of 5-(2-methoxy-1,3-dithian-2-yl)pyrrolidin-2-one (CID 102136140) is 5-(2-methoxy-1,3-dithian-2-yl)pyrrolidin-2-one.
What is the SMILES notation for 5-(2-methoxy-1,3-dithian-2-yl)pyrrolidin-2-one?
The canonical SMILES for 5-(2-methoxy-1,3-dithian-2-yl)pyrrolidin-2-one is COC1(C2CCC(=O)N2)SCCCS1.
What is the InChIKey of 5-(2-methoxy-1,3-dithian-2-yl)pyrrolidin-2-one?
The InChIKey is BVAMZSHHXCUPKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO2S2/c1-12-9(13-5-2-6-14-9)7-3-4-8(11)10-7/h7H,2-6H2,1H3,(H,10,11).
What are the key properties of 5-(2-methoxy-1,3-dithian-2-yl)pyrrolidin-2-one?
5-(2-methoxy-1,3-dithian-2-yl)pyrrolidin-2-one has a molecular weight of 233.36 g/mol, XLogP of 1.44, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-methoxy-1,3-dithian-2-yl)pyrrolidin-2-one is sourced from PubChem (CID 102136140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).