C12H20F3NO — CID 102136232
(2Z)-N,N-diethyl-2-(2,2,2-trifluoroethylidene)hexanamide (PubChem CID 102136232) has the molecular formula C12H20F3NO and a molecular weight of 251.29 g/mol. Its IUPAC name is (2Z)-N,N-diethyl-2-(2,2,2-trifluoroethylidene)hexanamide.
| Compound Name | (2Z)-N,N-diethyl-2-(2,2,2-trifluoroethylidene)hexanamide |
|---|---|
| PubChem CID | 102136232 |
| Molecular Formula | C12H20F3NO |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | (2Z)-N,N-diethyl-2-(2,2,2-trifluoroethylidene)hexanamide |
| SMILES | CCCC/C(=C/C(F)(F)F)C(=O)N(CC)CC |
| InChI | InChI=1S/C12H20F3NO/c1-4-7-8-10(9-12(13,14)15)11(17)16(5-2)6-3/h9H,4-8H2,1-3H3/b10-9- |
| InChIKey | MGLOEMRLCYEKSN-KTKRTIGZSA-N |
| XLogP | 3.53 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|