C22H18BF10N — CID 102136345
bis(2,3,4,5,6-pentafluorophenyl)-(2-piperidin-1-ylcyclopentyl)borane (PubChem CID 102136345) has the molecular formula C22H18BF10N and a molecular weight of 497.19 g/mol. Its IUPAC name is bis(2,3,4,5,6-pentafluorophenyl)-(2-piperidin-1-ylcyclopentyl)borane.
| Compound Name | bis(2,3,4,5,6-pentafluorophenyl)-(2-piperidin-1-ylcyclopentyl)borane |
|---|---|
| PubChem CID | 102136345 |
| Molecular Formula | C22H18BF10N |
| Molecular Weight | 497.19 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | bis(2,3,4,5,6-pentafluorophenyl)-(2-piperidin-1-ylcyclopentyl)borane |
| SMILES | Fc1c(F)c(F)c(B(c2c(F)c(F)c(F)c(F)c2F)C2CCCC2N2CCCCC2)c(F)c1F |
| InChI | InChI=1S/C22H18BF10N/c24-13-11(14(25)18(29)21(32)17(13)28)23(12-15(26)19(30)22(33)20(31)16(12)27)9-5-4-6-10(9)34-7-2-1-3-8-34/h9-10H,1-8H2 |
| InChIKey | XITNDBZOQDBKRP-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.19 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|