C26H38O5 — CID 102136363
(2R,4'R,4aR,6'S,8aR)-4'-[(3,3-dimethylcyclohexen-1-yl)methyl]-4-(hydroxymethyl)-6'-methoxy-4',7-dimethylspiro[5,8a-dihydro-4aH-chromene-2,2'-oxane]-6-one (PubChem CID 102136363) has the molecular formula C26H38O5 and a molecular weight of 430.59 g/mol. Its IUPAC name is (2R,4'R,4aR,6'S,8aR)-4'-[(3,3-dimethylcyclohexen-1-yl)methyl]-4-(hydroxymethyl)-6'-methoxy-4',7-dimethylspiro[5,8a-dihydro-4aH-chromene-2,2'-oxane]-6-one.
| Compound Name | (2R,4'R,4aR,6'S,8aR)-4'-[(3,3-dimethylcyclohexen-1-yl)methyl]-4-(hydroxymethyl)-6'-methoxy-4',7-dimethylspiro[5,8a-dihydro-4aH-chromene-2,2'-oxane]-6-one |
|---|---|
| PubChem CID | 102136363 |
| Molecular Formula | C26H38O5 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | (2R,4'R,4aR,6'S,8aR)-4'-[(3,3-dimethylcyclohexen-1-yl)methyl]-4-(hydroxymethyl)-6'-methoxy-4',7-dimethylspiro[5,8a-dihydro-4aH-chromene-2,2'-oxane]-6-one |
| SMILES | CO[C@@H]1C[C@@](C)(CC2=CC(C)(C)CCC2)C[C@]2(C=C(CO)[C@H]3CC(=O)C(C)=C[C@H]3O2)O1 |
| InChI | InChI=1S/C26H38O5/c1-17-9-22-20(10-21(17)28)19(15-27)13-26(30-22)16-25(4,14-23(29-5)31-26)12-18-7-6-8-24(2,3)11-18/h9,11,13,20,22-23,27H,6-8,10,12,14-16H2,1-5H3/t20-,22-,23+,25-,26+/m1/s1 |
| InChIKey | MCVWNQNHJWTLJN-ZZMIMLCOSA-N |
| XLogP | 4.85 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|