C37H64O6S4 — CID 102136371
1,3-bis[5-(dithiolan-3-yl)pentanoyloxy]propan-2-yl (Z)-octadec-9-enoate (PubChem CID 102136371) has the molecular formula C37H64O6S4 and a molecular weight of 733.18 g/mol. Its IUPAC name is 1,3-bis[5-(dithiolan-3-yl)pentanoyloxy]propan-2-yl (Z)-octadec-9-enoate.
| Compound Name | 1,3-bis[5-(dithiolan-3-yl)pentanoyloxy]propan-2-yl (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 102136371 |
| Molecular Formula | C37H64O6S4 |
| Molecular Weight | 733.18 g/mol |
| Exact Mass | 732.36 |
| IUPAC Name | 1,3-bis[5-(dithiolan-3-yl)pentanoyloxy]propan-2-yl (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC(COC(=O)CCCCC1CCSS1)COC(=O)CCCCC1CCSS1 |
| InChI | InChI=1S/C37H64O6S4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-25-37(40)43-32(30-41-35(38)23-19-17-21-33-26-28-44-46-33)31-42-36(39)24-20-18-22-34-27-29-45-47-34/h9-10,32-34H,2-8,11-31H2,1H3/b10-9- |
| InChIKey | RWPQMVFOFRLRHL-KTKRTIGZSA-N |
| XLogP | 11.45 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.18 |
| LogP ≤ 5 | 11.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|