About diethyl 2-[(1R,2R)-2-cyano-1-(4-fluorophenyl)-2-(4-nitrophenyl)ethyl]propanedioate
diethyl 2-[(1R,2R)-2-cyano-1-(4-fluorophenyl)-2-(4-nitrophenyl)ethyl]propanedioate (PubChem CID 102136980) has the molecular formula C22H21FN2O6
and a molecular weight of 428.42 g/mol. Its IUPAC name is diethyl 2-[(1R,2R)-2-cyano-1-(4-fluorophenyl)-2-(4-nitrophenyl)ethyl]propanedioate.
Molecular Properties
| Compound Name | diethyl 2-[(1R,2R)-2-cyano-1-(4-fluorophenyl)-2-(4-nitrophenyl)ethyl]propanedioate |
| PubChem CID | 102136980 |
| Molecular Formula | C22H21FN2O6 |
| Molecular Weight | 428.42 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | diethyl 2-[(1R,2R)-2-cyano-1-(4-fluorophenyl)-2-(4-nitrophenyl)ethyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)[C@H](c1ccc(F)cc1)[C@@H](C#N)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H21FN2O6/c1-3-30-21(26)20(22(27)31-4-2)19(15-5-9-16(23)10-6-15)18(13-24)14-7-11-17(12-8-14)25(28)29/h5-12,18-20H,3-4H2,1-2H3/t18-,19+/m0/s1 |
| InChIKey | NLGVXMUBQPHZRO-RBUKOAKNSA-N |
| XLogP | 3.87 |
| TPSA | 119.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.42 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-[(1R,2R)-2-cyano-1-(4-fluorophenyl)-2-(4-nitrophenyl)ethyl]propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-[(1R,2R)-2-cyano-1-(4-fluorophenyl)-2-(4-nitrophenyl)ethyl]propanedioate?
The IUPAC name of diethyl 2-[(1R,2R)-2-cyano-1-(4-fluorophenyl)-2-(4-nitrophenyl)ethyl]propanedioate (CID 102136980) is diethyl 2-[(1R,2R)-2-cyano-1-(4-fluorophenyl)-2-(4-nitrophenyl)ethyl]propanedioate.
What is the SMILES notation for diethyl 2-[(1R,2R)-2-cyano-1-(4-fluorophenyl)-2-(4-nitrophenyl)ethyl]propanedioate?
The canonical SMILES for diethyl 2-[(1R,2R)-2-cyano-1-(4-fluorophenyl)-2-(4-nitrophenyl)ethyl]propanedioate is CCOC(=O)C(C(=O)OCC)[C@H](c1ccc(F)cc1)[C@@H](C#N)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of diethyl 2-[(1R,2R)-2-cyano-1-(4-fluorophenyl)-2-(4-nitrophenyl)ethyl]propanedioate?
The InChIKey is NLGVXMUBQPHZRO-RBUKOAKNSA-N. The full InChI is InChI=1S/C22H21FN2O6/c1-3-30-21(26)20(22(27)31-4-2)19(15-5-9-16(23)10-6-15)18(13-24)14-7-11-17(12-8-14)25(28)29/h5-12,18-20H,3-4H2,1-2H3/t18-,19+/m0/s1.
What are the key properties of diethyl 2-[(1R,2R)-2-cyano-1-(4-fluorophenyl)-2-(4-nitrophenyl)ethyl]propanedioate?
diethyl 2-[(1R,2R)-2-cyano-1-(4-fluorophenyl)-2-(4-nitrophenyl)ethyl]propanedioate has a molecular weight of 428.42 g/mol, XLogP of 3.87, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-[(1R,2R)-2-cyano-1-(4-fluorophenyl)-2-(4-nitrophenyl)ethyl]propanedioate is sourced from PubChem (CID 102136980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).